Name |
Naringenin (-)-Naringenin |
Formula |
C15H12O5 |
Mw |
272.06847349 |
CAS RN |
480-41-1 |
C_ID |
C00000982
,
|
InChIKey |
FTVWIRXFELQLPI-UGPWUYPHNA-N |
InChICode |
InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2/t13-/m0/s1 |
SMILES |
O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Anacardium occidentale | Ref. |
Plantae | Annonaceae | Xylopia poilanei | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asphodelaceae | Aloe spp. | Ref. |
Plantae | Asteraceae | Artemisia campestris ssp.maritima | Ref. |
Plantae | Asteraceae | Artemisia glutinosa | Ref. |
Plantae | Asteraceae | Artemisia spp. | Ref. |
Plantae | Asteraceae | Baccharis spp. | Ref. |
Plantae | Asteraceae | Centaurea spp. | Ref. |
Plantae | Asteraceae | Chrysothamnus humilis | Ref. |
Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
Plantae | Asteraceae | Dahlia spp. | Ref. |
Plantae | Asteraceae | Helichrysum arenarium | Ref. |
Plantae | Asteraceae | Helichrysum bracteatum (Vent.)Andr. | Ref. |
Plantae | Asteraceae | Helichrysum graveolen | Ref. |
Plantae | Asteraceae | Polymnia fruticosa | Ref. |
Plantae | Boraginaceae | Heliotropium sclerocarpum | Ref. |
Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
Plantae | Cannabaceae | Cannabis indica | Ref. |
Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
Plantae | Cannabaceae | Cannabis sativa | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Chchlospermaceae | Cochlospermum gillivraei | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia multiflora | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia neglecta | Ref. |
Plantae | Combretaceae | Terminalia fagifolia | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Acacia longifolia | Ref. |
Plantae | Fabaceae | Bauhinia guianensis | Ref. |
Plantae | Fabaceae | Crotalaria assamica | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
Plantae | Fabaceae | Flemingia stricta | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Intsia bijuga | Ref. |
Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
Plantae | Fabaceae | Lupinus subcarnosus | Ref. |
Plantae | Fabaceae | Lupinus texensis | Ref. |
Plantae | Fabaceae | Medicago arabica | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Millettia brandisiana | Ref. |
Plantae | Fabaceae | Mimosa hostilis | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Rhynchosia beddomei | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Swartzia polyphylla | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca | Ref. |
Plantae | Gentianaceae | Gentiana triflora | Ref. |
Plantae | Gesneriaceae | Aeschynanthus bracteatus | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Origanum acutidens | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum majoricum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Phlomis caucasica | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Linaceae | Linum austriacum subsp.glaucescens | Ref. |
Plantae | Linaceae | Linum hirsutum subsp.anatolicum | Ref. |
Plantae | Linaceae | Linum tenuifolium | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Moraceae | Broussonetia papyrifera | Ref. |
Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea | Ref. |
Plantae | Moraceae | Maclura tinctoria | Ref. |
Plantae | Musaceae | Musa acuminata | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Orchidaceae | Dendrobium densiflorum Lindl.ex.Wall. | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
Plantae | Piperaceae | Piper crassinervium Kunth | Ref. |
Plantae | Plantaginaceae | Antirrhinum majus | Ref. |
Plantae | Poaceae | Gynerium sagittatum | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Prunus cerasus | Ref. |
Plantae | Rosaceae | Prunus davidiana | Ref. |
Plantae | Rosaceae | Prunus mume | Ref. |
Plantae | Rosaceae | Prunus persica | Ref. |
Plantae | Rosaceae | Prunus yedoensis | Ref. |
Plantae | Rutaceae | Citrus aurantium L. var. amara | Ref. |
Plantae | Rutaceae | Citrus grandis | Ref. |
Plantae | Rutaceae | Citrus grandis var.tomentosa | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Citrus unshiu | Ref. |
Plantae | Salicaceae | Salix purpurea | Ref. |
Plantae | Santalaceae | Viscum angulatum | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Petunia hybrida | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis var.assamica | Ref. |
Plantae | Typhaceae | Typha angustifolia | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Verbenaceae | Verbena hybrida | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
- | - | Equsetum arvense | Ref. |
- | - | Moghania philippinensis | Ref. |
- | - | Nympaea spp. | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
Organism | Prunus davidiana | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Wei, et al., CCMM, 22, (1997), 228.
Shang, et al., CCMM, 23, (1998), 614.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Hou, et al., JNP, 64, (2001), 65.
Lee, et al., JNP, 64, (2001), 1286.
Danelutte, et al., Phytochemistry, 64, (2003), 555.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
Calixto, et al., Planta Med, 69, (2003), 973.
Lin, et al., JNP, 65, (2002), 638.
Chiang, et al., JNP, 66, (2003), 1070.
Park, et al., Planta Med, 71, (2005), 24.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|