Name |
Liquiritigenin |
Formula |
C15H12O4 |
Mw |
256.07355887 |
CAS RN |
578-86-9 |
C_ID |
C00000977
,
|
InChIKey |
FURUXTVZLHCCNA-YQTOOIBONA-N |
InChICode |
InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1 |
SMILES |
c1(ccc2c(c1)O[C@@H](CC2=O)c1ccc(cc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaryllidaceae | Crinum bulbispermum Milne | Ref. |
Plantae | Amaryllidaceae | Pancratium maritimum L. | Ref. |
Plantae | Berberidaceae | Epimedium koreanum | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Dracaenaceae | Dracaena draco | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Bauhinia guianensis | Ref. |
Plantae | Fabaceae | Centrolobium robustum | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Dalbergia ecastaphyllum | Ref. |
Plantae | Fabaceae | Dalbergia latifolia | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dalbergia sissoides | Ref. |
Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
Plantae | Fabaceae | Diplotropis purpurea | Ref. |
Plantae | Fabaceae | Echinosophora koreensis | Ref. |
Plantae | Fabaceae | Erythrina fusca | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza echinata | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
Plantae | Fabaceae | Medicago lupulina | Ref. |
Plantae | Fabaceae | Medicago radiata | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Melilotus altissimus | Ref. |
Plantae | Fabaceae | Melilotus dentatus | Ref. |
Plantae | Fabaceae | Melilotus elegans | Ref. |
Plantae | Fabaceae | Melilotus infestus | Ref. |
Plantae | Fabaceae | Melilotus italica | Ref. |
Plantae | Fabaceae | Melilotus messanensis | Ref. |
Plantae | Fabaceae | Melilotus neapolitanus | Ref. |
Plantae | Fabaceae | Melilotus officinalis subsp. suaveolens | Ref. |
Plantae | Fabaceae | Melilotus polonicus | Ref. |
Plantae | Fabaceae | Melilotus tauricus | Ref. |
Plantae | Fabaceae | Melilotus wolgicus | Ref. |
Plantae | Fabaceae | Onobrychis sp. | Ref. |
Plantae | Fabaceae | Onobrychis viciifolia Scop. | Ref. |
Plantae | Fabaceae | Peltogyne paniculata | Ref. |
Plantae | Fabaceae | Peltogyne sp. | Ref. |
Plantae | Fabaceae | Peltogyne venosa | Ref. |
Plantae | Fabaceae | Pericopsis elata | Ref. |
Plantae | Fabaceae | Pericopsis mooniana | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Pterocarpus angolensis | Ref. |
Plantae | Fabaceae | Pterocarpus macrocarpus | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
Plantae | Fabaceae | Pueraria lobata | Ref. |
Plantae | Fabaceae | Robinia pseudoacacia | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora gypsophila | Ref. |
Plantae | Fabaceae | Sophora secundiflora | Ref. |
Plantae | Fabaceae | Spatholobus suberectus Dunn | Ref. |
Plantae | Fabaceae | Trifolium subterraneum | Ref. |
Plantae | Fabaceae | Umtiza listerana | Ref. |
Plantae | Moraceae | Brosimum acutifolium | Ref. |
Plantae | Rutaceae | Clausena excavata | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Datura innoxia | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
- | - | Moghania philippinensis | Ref. |
|
|
zoom in
Organism | Medicago radiata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|