Name |
Hesperetin |
Formula |
C16H14O6 |
Mw |
302.07903818 |
CAS RN |
520-33-2 |
C_ID |
C00000968
,
|
InChIKey |
AIONOLUJZLIMTK-YQTOOIBONA-N |
InChICode |
InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1cc(c(cc1)OC)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Araceae | Anthurium spp. | Ref. |
Plantae | Asteraceae | Brickellia vernicosa | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Isatis indigotica | Ref. |
Plantae | Fabaceae | Dalbergia parviflora | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Labiatae | Mentha aquatica L. | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Rosaceae | Prunus persica | Ref. |
Plantae | Rutaceae | Citrus aurantium L. var. amara | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Verbenaceae | Verbena hybrida | Ref. |
- | - | Mentha | Ref. |
|
|
zoom in
Organism | Origanum majorana | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|