Name |
Eriodictyol (+)-Eriodictyol (+)-Eriodictol |
Formula |
C15H12O6 |
Mw |
288.06338812 |
CAS RN |
552-58-9 |
C_ID |
C00000960
,
|
InChIKey |
SBHXYTNGIZCORC-UGPWUYPHNA-N |
InChICode |
InChI=1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Asteraceae | Anthemis altissima | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
Plantae | Asteraceae | Eupatorium subhastatum | Ref. |
Plantae | Asteraceae | Filifolium sibiricum | Ref. |
Plantae | Asteraceae | Helichrysum bracteatum (Vent.)Andr. | Ref. |
Plantae | Asteraceae | Onopordum acanthium | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Tessaria dodoneifolia | Ref. |
Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia conrauana | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia livingstonei | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
Plantae | Ericaceae | Lyonia ovalifolia | Ref. |
Plantae | Erythroxylaceae | Erythroxylum australe | Ref. |
Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
Plantae | Fabaceae | Acacia pennatula | Ref. |
Plantae | Fabaceae | Arachis hypogaea | Ref. |
Plantae | Fabaceae | Bauhinia guianensis | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Dipteryx odorata | Ref. |
Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Spatholobus suberectus Dunn | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon californicum | Ref. |
Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
Plantae | Labiatae | Mentha longifolia | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Phlomis nissolii | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
Plantae | Rosaceae | Prunus armygdalus | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus unshiu Markovich | Ref. |
Plantae | Salicaceae | Salix purpurea | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
- | - | Saracha punctata | Ref. |
|
|
zoom in
Organism | Origanum dictamnus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|