Name |
Afzelechin |
Formula |
C15H14O5 |
Mw |
274.08412356 |
CAS RN |
2545-00-8 |
C_ID |
C00000937
,
|
InChIKey |
RSYUFYQTACJFML-UYWMCZCJNA-N |
InChICode |
InChI=1S/C15H14O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-6,13,15-19H,7H2/t13-,15+/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H]([C@H](C2)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Actinidiaceae | Actinidia chinensis | Ref. |
Plantae | Chchlospermaceae | Cochlospermum gillivraei | Ref. |
Plantae | Cupressaceae | Juniperus communis | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Fabaceae | Acacia catechu | Ref. |
Plantae | Fabaceae | Cassia abbreviata | Ref. |
Plantae | Fabaceae | Cassia javanica | Ref. |
Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Moraceae | Artocarpus fretessi Hassk | Ref. |
Plantae | Moraceae | Artocarpus reticulatus Miq | Ref. |
Plantae | Myrtaceae | Eucalyptus calophylla | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus fusca | Ref. |
Plantae | Palmae | Desmoncus polyacanthos | Ref. |
Plantae | Palmae | Desmoncus polycanthus | Ref. |
Plantae | Pinaceae | Larix sibirica | Ref. |
Plantae | Rhizophoraceae | Cassipourea gummiflua | Ref. |
Plantae | Rhizophoraceae | Kandelia candel | Ref. |
Plantae | Rosaceae | Prunus persica | Ref. |
Plantae | Saxifragaceae | Bergenia ligulata | Ref. |
Plantae | Saxifragaceae | Saxifraga ligulata | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Typhaceae | Typha capensis (Rohrb.) N. E. Br | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
Organism | Cochlospermum gillivraei | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Hillis,Aust.J.Chem.,13,(1960),390
Hillis,Phytochem.,6,(1967),59 |
---|
|