Name |
beta-Nerol Nerol cis-Geraniol (Z)-Geraniol |
Formula |
C10H18O |
Mw |
154.1357652 |
CAS RN |
106-25-2 |
C_ID |
C00000855
,
|
InChIKey |
GLZPCOQZEFWAFX-YFHOEESVSA-N |
InChICode |
InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
SMILES |
C(CC=C(C)C)/C(=C\CO)/C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Cananga odorata | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Chamomilla rectita | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Geraniaceae | Pelargonium graveolens | Ref. |
Plantae | Labiatae | Dracocephalum moldavicum | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Litsea cubeba | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Oleaceae | Osmanthus fragrans | Ref. |
Plantae | Piperaceae | Piper arboreum | Ref. |
Plantae | Piperaceae | Piper fimbriulatum | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Rosa rugosa | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus aurantium var.amara | Ref. |
Plantae | Rutaceae | Citrus grandis | Ref. |
Plantae | Rutaceae | Citrus junos | Ref. |
Plantae | Rutaceae | Citrus laurifolius | Ref. |
Plantae | Rutaceae | Citrus limettioides | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Nicotiana tobacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Eriobtrya japonica | Ref. |
|
|
zoom in
Organism | Zingiber officinale | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
---|
|