Name |
beta-Thujone Isothujone cis-Thujone (+)-Thujone |
Formula |
C10H16O |
Mw |
152.12011513 |
CAS RN |
471-15-8 |
C_ID |
C00000836
,
|
InChIKey |
USMNOWBWPHYOEA-XHIRJPDHNA-N |
InChICode |
InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3/t7-,8+,10-/m0/s1 |
SMILES |
C1(=O)C[C@@]2(C[C@@H]2[C@@H]1C)C(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Asteraceae | Artemisia herba-alba | Ref. |
Plantae | Asteraceae | Artemisia vulgaris | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare | Ref. |
Plantae | Chenopodiaceae | Chenopodium ambrosioides | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cupressaceae | Thuja plicata | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
- | - | Alphinia galanga | Ref. |
|
|
zoom in
Organism | Artemisia herba-alba | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|