Name |
(+)-Camphor Camphor |
Formula |
C10H16O |
Mw |
152.12011513 |
CAS RN |
76-22-2 |
C_ID |
C00000819
,
|
InChIKey |
DSSYKIVIOFKYAU-NAJNNQRLNA-N |
InChICode |
InChI=1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
SMILES |
[C@@H]12CC[C@@](C(=O)C1)(C2(C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Plantae | Acoraceae | Acorus calamus | Ref. |
Plantae | Acoraceae | Acorus calanus L. | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Coriandrum sativum | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Asparagaceae | Asparagus racemosus | Ref. |
Plantae | Asteraceae | Achillea alpina | Ref. |
Plantae | Asteraceae | Achillea santolinoids | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia herba-alba | Ref. |
Plantae | Asteraceae | Artemisia sativum | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chrysanthemum vulgare | Ref. |
Plantae | Asteraceae | Conyza newii | Ref. |
Plantae | Asteraceae | Dittrichia graveolens | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus | Ref. |
Plantae | Chenopodiaceae | Chenopodium ambrosioides | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Dipterocarpaceae | Dryobalanops aromatica | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula bipinnata | Ref. |
Plantae | Labiatae | Lavandula dentata | Ref. |
Plantae | Labiatae | Lavandula latifolia | Ref. |
Plantae | Labiatae | Lavandula stoechas | Ref. |
Plantae | Labiatae | Meriandra benghalensis | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja douglasii | Ref. |
Plantae | Labiatae | Tetradenia riparia | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus magnus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus quinquecostatus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum Camphora Sieb. | Ref. |
Plantae | Lauraceae | Cinnamomum zeylanicum | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Oleaceae | Forsythia suspensa | Ref. |
Plantae | Pinaceae | Pinus eldarica | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus pallasiana | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pinus sosnowskyi | Ref. |
Plantae | Pinaceae | Pinus sylvestris L.var.sylvestris. | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Rosaceae | Eriobotrya japonica | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus wallichiana | Ref. |
Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansi | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Verbenaceae | Lippia javanica | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Zingiberaceae | Alpinia galanga | Ref. |
Plantae | Zingiberaceae | Alpinia japonica | Ref. |
Plantae | Zingiberaceae | Amomum villosum | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
Plantae | Zingiberaceae | Curcuma zedoaria | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Lavandin abrialis | Ref. |
|
|
zoom in
Organism | Thymus broussonetti | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|