Name |
Dihydroquercetin Taxifolin (2R,3R)-Taxifolin Distylin |
Formula |
C15H12O7 |
Mw |
304.05830274 |
CAS RN |
480-18-2 |
C_ID |
C00000677
,
|
InChIKey |
CXQWRCVTCMQVQX-PVRQQBJHNA-N |
InChICode |
InChI=1S/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/m0/s1 |
SMILES |
c1(cc(c2c(c1)O[C@@H]([C@H](C2=O)O)c1cc(c(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Anacardiaceae | Melanorrhoea spp. | Ref. |
Plantae | Anacardiaceae | Pistacia chinensis | Ref. |
Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Annonaceae | Cleistopholis glauca | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Asparagaceae | Asparagus officinalis | Ref. |
Plantae | Asteraceae | Anthemis altissima | Ref. |
Plantae | Asteraceae | Pulicaria undulata | Ref. |
Plantae | Boraginaceae | Heliotropium strigosum | Ref. |
Plantae | Cactaceae | Opuntia ficus-indica var.saboten | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Platycodon grandiflorum | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia epunctata | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica carinata Y line | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Dilleniaceae | Dillenia spp. | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Ericaceae | Rhododendron brachycarpum ssp.brachycarpum | Ref. |
Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
Plantae | Ericaceae | Rhododendron degronianum ssp. Heptamerum var. hondoense | Ref. |
Plantae | Ericaceae | Rhododendron dichroanthum ssp.scyphocalyx | Ref. |
Plantae | Ericaceae | Rhododendron fortunei | Ref. |
Plantae | Ericaceae | Rhododendron insigne | Ref. |
Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
Plantae | Ericaceae | Rhododendron ponticum | Ref. |
Plantae | Ericaceae | Rhododendron praevernum | Ref. |
Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Ericaceae | Rhododendron ungernii | Ref. |
Plantae | Erythroxylaceae | Erythroxylum coca | Ref. |
Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
Plantae | Fabaceae | Acacia carnei | Ref. |
Plantae | Fabaceae | Acacia catechu | Ref. |
Plantae | Fabaceae | Colophospermum mopane | Ref. |
Plantae | Fabaceae | Crotalaria assamica | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Genista corsica | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Spatholobus suberectus Dunn | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Haemodoraceae | Anigozanthos pulcherrimus | Ref. |
Plantae | Haemodoraceae | Anigozanthos rufus | Ref. |
Plantae | Juglandaceae | Juglans mandshurica | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lauraceae | Neolitsea konishii | Ref. |
Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
Plantae | Lythraceae | Punica granatum L. | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
Plantae | Orchidaceae | Gongora quinquenervis | Ref. |
Plantae | Orchidaceae | Neomoorea wallisii | Ref. |
Plantae | Pinaceae | Cedrus deodara | Ref. |
Plantae | Pinaceae | Larix decidua | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Pinaceae | Picea obovata | Ref. |
Plantae | Pinaceae | Pinus roxburghii | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
Plantae | Plantaginaceae | Antirrhinum majus | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Polygalaceae | Polygala caudata | Ref. |
Plantae | Polygonaceae | Polygonum amphibium | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum bistorta | Ref. |
Plantae | Polygonaceae | Polygonum convolvulus | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper | Ref. |
Plantae | Polygonaceae | Polygonum lapathifolium | Ref. |
Plantae | Polygonaceae | Polygonum mite | Ref. |
Plantae | Polygonaceae | Polygonum nodosum | Ref. |
Plantae | Polygonaceae | Polygonum orientale | Ref. |
Plantae | Polygonaceae | Polygonum persicaria | Ref. |
Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Salicaceae | Salix caprea | Ref. |
Plantae | Salicaceae | Salix purpurea | Ref. |
Plantae | Sapindaceae | Xanthoceras sorbifolia | Ref. |
Plantae | Schisandraceae | Kadsura heteroclita | Ref. |
Plantae | Smilacaceae | Smilax glabra | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Petunia hybrida | Ref. |
Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus mairei | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Verbenaceae | Lippia sidoides | Ref. |
- | - | Equsetum arvense | Ref. |
- | - | Nympaea spp. | Ref. |
|
|
zoom in
Organism | Pulicaria undulata | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 694,Flavanones and dihydroflavonols
Hillis,Bot.J.Linn.Soc.,58,(1962),175
King,J.Chem.Soc.,(1962),1192 |
---|
|