Name |
(-)-Podophyllotoxin Podophyllotoxin |
Formula |
C22H22O8 |
Mw |
414.13146768 |
CAS RN |
518-28-5 |
C_ID |
C00000610
,
|
InChIKey |
YJGVMLPVUAXIQN-IJUAZSIVNA-N |
InChICode |
InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18-,19-,20-/m0/s1 |
SMILES |
COc1cc(C2c3cc4c(cc3C(O)C3COC(=O)C23)OCO4)cc(OC)c1OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Anthriscus sylvestris | Ref. |
Plantae | Berberidaceae | Diphylleia grayi | Ref. |
Plantae | Berberidaceae | Diphylleia sinensis | Ref. |
Plantae | Berberidaceae | Dysosma majorensis | Ref. |
Plantae | Berberidaceae | Dysosma veitchii | Ref. |
Plantae | Berberidaceae | Podophyllum emodi Wall | Ref. |
Plantae | Berberidaceae | Podophyllum hexandrum | Ref. |
Plantae | Berberidaceae | Podophyllum peltatum | Ref. |
Plantae | Berberidaceae | Podophyllum pleianthum | Ref. |
Plantae | Berberidaceae | Sinopodophyllum emodi | Ref. |
Plantae | Berberidaceae | Sinopodophyllum hexandrum | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cupressaceae | Callitris drummondii | Ref. |
Plantae | Cupressaceae | Juniperus chinensis | Ref. |
Plantae | Cupressaceae | Juniperus phoenicea | Ref. |
Plantae | Cupressaceae | Juniperus sabina | Ref. |
Plantae | Cupressaceae | Juniperus thurifera | Ref. |
Plantae | Cupressaceae | Juniperus virginiana | Ref. |
Plantae | Labiatae | Hyptis verticillata | Ref. |
Plantae | Linaceae | Hugonia tomentosa | Ref. |
Plantae | Linaceae | Linum album | Ref. |
Plantae | Linaceae | Linum boissieri | Ref. |
Plantae | Linaceae | Linum cariense | Ref. |
Plantae | Linaceae | Linum catharticum | Ref. |
Plantae | Linaceae | Linum flavum var. compactum | Ref. |
Plantae | Linaceae | Linum mucronatum ssp. armenum | Ref. |
Plantae | Linderniaceae | Micranthemum umbrosum | Ref. |
Plantae | Polygalaceae | Polygala polygama | Ref. |
|
|
zoom in
Organism | Linum cariense | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|