Name |
Ficusin Psoralen |
Formula |
C11H6O3 |
Mw |
186.03169406 |
CAS RN |
66-97-7 |
C_ID |
C00000297
,
|
InChIKey |
ZCCUUQDIBDJBTK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H |
SMILES |
c12c(cc3c(c1)ccc(=O)o3)occ2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Ammi majus | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Arracacia xanthorrhiza | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Apiaceae | Glehnia littoralis | Ref. |
Plantae | Apiaceae | Heracleum lanatum | Ref. |
Plantae | Apiaceae | Heracleum levskovii | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
Plantae | Apiaceae | Prionosciadium thapsoides | Ref. |
Plantae | Apiaceae | Saposhnikovia divaricata Schischkin | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Fabaceae | Bituminaria bituminosa | Ref. |
Plantae | Fabaceae | Coronilla coronata | Ref. |
Plantae | Fabaceae | Coronilla glauca | Ref. |
Plantae | Fabaceae | Coronilla juncea | Ref. |
Plantae | Fabaceae | Coronilla minima | Ref. |
Plantae | Fabaceae | Coronilla repanda | Ref. |
Plantae | Fabaceae | Coronilla scorpioides | Ref. |
Plantae | Fabaceae | Coronilla valentina | Ref. |
Plantae | Fabaceae | Coronilla viminalis | Ref. |
Plantae | Fabaceae | Cullen corylifolium | Ref. |
Plantae | Fabaceae | Cullen drupaceum | Ref. |
Plantae | Fabaceae | Cullen obtusifolium | Ref. |
Plantae | Fabaceae | Cullen plicatum | Ref. |
Plantae | Fabaceae | Hoita macrostachya | Ref. |
Plantae | Fabaceae | Orbexilum pedunculatum | Ref. |
Plantae | Fabaceae | Otholobium bolusii | Ref. |
Plantae | Fabaceae | Otholobium candicans | Ref. |
Plantae | Fabaceae | Otholobium foliosum | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium obliquum | Ref. |
Plantae | Fabaceae | Otholobium parviflorum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Otholobium stachyerum | Ref. |
Plantae | Fabaceae | Otholobium zeyheri | Ref. |
Plantae | Fabaceae | Pediomelum subacaule | Ref. |
Plantae | Fabaceae | Psoralea affinis | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea cinerea | Ref. |
Plantae | Fabaceae | Psoralea coryfolia | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea exile | Ref. |
Plantae | Fabaceae | Psoralea fascicularis | Ref. |
Plantae | Fabaceae | Psoralea glabra | Ref. |
Plantae | Fabaceae | Psoralea lachnostachys | Ref. |
Plantae | Fabaceae | Psoralea leucantha | Ref. |
Plantae | Fabaceae | Psoralea martinii | Ref. |
Plantae | Fabaceae | Psoralea oreopolum | Ref. |
Plantae | Fabaceae | Psoralea papillosa | Ref. |
Plantae | Fabaceae | Psoralea pinnata | Ref. |
Plantae | Fabaceae | Psoralea plumosa | Ref. |
Plantae | Fabaceae | Psoralea pullata | Ref. |
Plantae | Fabaceae | Psoralea pustulata | Ref. |
Plantae | Fabaceae | Psoralea ramulosa | Ref. |
Plantae | Fabaceae | Psoralea repens | Ref. |
Plantae | Fabaceae | Psoralea speciosa | Ref. |
Plantae | Fabaceae | Psoralea verrucosa | Ref. |
Plantae | Fabaceae | Securigera cretica | Ref. |
Plantae | Fabaceae | Securigera orientalis | Ref. |
Plantae | Moraceae | Dorstenia asaroides | Ref. |
Plantae | Moraceae | Dorstenia bahiensis | Ref. |
Plantae | Moraceae | Dorstenia barnimiana | Ref. |
Plantae | Moraceae | Dorstenia brasiliensis | Ref. |
Plantae | Moraceae | Dorstenia bryonifolia | Ref. |
Plantae | Moraceae | Dorstenia cayapiaa | Ref. |
Plantae | Moraceae | Dorstenia contrajerva | Ref. |
Plantae | Moraceae | Dorstenia drakena | Ref. |
Plantae | Moraceae | Dorstenia excentria | Ref. |
Plantae | Moraceae | Dorstenia heringerii | Ref. |
Plantae | Moraceae | Dorstenia lindeniana | Ref. |
Plantae | Moraceae | Dorstenia psilurus | Ref. |
Plantae | Moraceae | Dorstenia turbinata | Ref. |
Plantae | Moraceae | Ficus arica | Ref. |
Plantae | Moraceae | Ficus carica | Ref. |
Plantae | Moraceae | Ficus hirta | Ref. |
Plantae | Moraceae | Ficus simplicissima | Ref. |
Plantae | Moraceae | Ficus sycomorus | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Citrus bergamia | Ref. |
Plantae | Rutaceae | Dictamnus hispanicus | Ref. |
Plantae | Rutaceae | Fagara mayu | Ref. |
Plantae | Rutaceae | Feronia limonia | Ref. |
Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
Plantae | Rutaceae | Phebalium argenteum | Ref. |
Plantae | Rutaceae | Phebalium clavatum | Ref. |
Plantae | Rutaceae | Ruta chalepensis L. | Ref. |
Plantae | Rutaceae | Ruta graveolens | Ref. |
Plantae | Rutaceae | Zanthoxylum flavum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
- | - | Sarcolobus globosus | Ref. |
|
|
zoom in
Organism | Plumbago zeylanica | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|