Name |
Ficusin Psoralen |
Formula |
C11H6O3 |
Mw |
186.03169406 |
CAS RN |
66-97-7 |
C_ID |
C00000297
,
|
InChIKey |
ZCCUUQDIBDJBTK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H |
SMILES |
c12c(cc3c(c1)ccc(=O)o3)occ2 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Ammi majus | Ref. |
Plantae | Apiaceae | Angelica pubescens f.biserrata | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Arracacia xanthorrhiza | Ref. |
Plantae | Apiaceae | Bupleurum scorzonerifolium | Ref. |
Plantae | Apiaceae | Glehnia littoralis | Ref. |
Plantae | Apiaceae | Heracleum lanatum | Ref. |
Plantae | Apiaceae | Heracleum levskovii | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
Plantae | Apiaceae | Prionosciadium thapsoides | Ref. |
Plantae | Apiaceae | Saposhnikovia divaricata Schischkin | Ref. |
Plantae | Asphodelaceae | Aloe vera | Ref. |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
Plantae | Fabaceae | Bituminaria bituminosa | Ref. |
Plantae | Fabaceae | Coronilla coronata | Ref. |
Plantae | Fabaceae | Coronilla glauca | Ref. |
Plantae | Fabaceae | Coronilla juncea | Ref. |
Plantae | Fabaceae | Coronilla minima | Ref. |
Plantae | Fabaceae | Coronilla repanda | Ref. |
Plantae | Fabaceae | Coronilla scorpioides | Ref. |
Plantae | Fabaceae | Coronilla valentina | Ref. |
Plantae | Fabaceae | Coronilla viminalis | Ref. |
Plantae | Fabaceae | Cullen corylifolium | Ref. |
Plantae | Fabaceae | Cullen drupaceum | Ref. |
Plantae | Fabaceae | Cullen obtusifolium | Ref. |
Plantae | Fabaceae | Cullen plicatum | Ref. |
Plantae | Fabaceae | Hoita macrostachya | Ref. |
Plantae | Fabaceae | Orbexilum pedunculatum | Ref. |
Plantae | Fabaceae | Otholobium bolusii | Ref. |
Plantae | Fabaceae | Otholobium candicans | Ref. |
Plantae | Fabaceae | Otholobium foliosum | Ref. |
Plantae | Fabaceae | Otholobium hirtum | Ref. |
Plantae | Fabaceae | Otholobium obliquum | Ref. |
Plantae | Fabaceae | Otholobium parviflorum | Ref. |
Plantae | Fabaceae | Otholobium sericeum | Ref. |
Plantae | Fabaceae | Otholobium stachyerum | Ref. |
Plantae | Fabaceae | Otholobium zeyheri | Ref. |
Plantae | Fabaceae | Pediomelum subacaule | Ref. |
Plantae | Fabaceae | Psoralea affinis | Ref. |
Plantae | Fabaceae | Psoralea arborea | Ref. |
Plantae | Fabaceae | Psoralea cinerea | Ref. |
Plantae | Fabaceae | Psoralea coryfolia | Ref. |
Plantae | Fabaceae | Psoralea corylifolia | Ref. |
Plantae | Fabaceae | Psoralea effusa | Ref. |
Plantae | Fabaceae | Psoralea exile | Ref. |
Plantae | Fabaceae | Psoralea fascicularis | Ref. |
Plantae | Fabaceae | Psoralea glabra | Ref. |
Plantae | Fabaceae | Psoralea lachnostachys | Ref. |
Plantae | Fabaceae | Psoralea leucantha | Ref. |
Plantae | Fabaceae | Psoralea martinii | Ref. |
Plantae | Fabaceae | Psoralea oreopolum | Ref. |
Plantae | Fabaceae | Psoralea papillosa | Ref. |
Plantae | Fabaceae | Psoralea pinnata | Ref. |
Plantae | Fabaceae | Psoralea plumosa | Ref. |
Plantae | Fabaceae | Psoralea pullata | Ref. |
Plantae | Fabaceae | Psoralea pustulata | Ref. |
Plantae | Fabaceae | Psoralea ramulosa | Ref. |
Plantae | Fabaceae | Psoralea repens | Ref. |
Plantae | Fabaceae | Psoralea speciosa | Ref. |
Plantae | Fabaceae | Psoralea verrucosa | Ref. |
Plantae | Fabaceae | Securigera cretica | Ref. |
Plantae | Fabaceae | Securigera orientalis | Ref. |
Plantae | Moraceae | Dorstenia asaroides | Ref. |
Plantae | Moraceae | Dorstenia bahiensis | Ref. |
Plantae | Moraceae | Dorstenia barnimiana | Ref. |
Plantae | Moraceae | Dorstenia brasiliensis | Ref. |
Plantae | Moraceae | Dorstenia bryonifolia | Ref. |
Plantae | Moraceae | Dorstenia cayapiaa | Ref. |
Plantae | Moraceae | Dorstenia contrajerva | Ref. |
Plantae | Moraceae | Dorstenia drakena | Ref. |
Plantae | Moraceae | Dorstenia excentria | Ref. |
Plantae | Moraceae | Dorstenia heringerii | Ref. |
Plantae | Moraceae | Dorstenia lindeniana | Ref. |
Plantae | Moraceae | Dorstenia psilurus | Ref. |
Plantae | Moraceae | Dorstenia turbinata | Ref. |
Plantae | Moraceae | Ficus arica | Ref. |
Plantae | Moraceae | Ficus carica | Ref. |
Plantae | Moraceae | Ficus hirta | Ref. |
Plantae | Moraceae | Ficus simplicissima | Ref. |
Plantae | Moraceae | Ficus sycomorus | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Citrus bergamia | Ref. |
Plantae | Rutaceae | Dictamnus hispanicus | Ref. |
Plantae | Rutaceae | Fagara mayu | Ref. |
Plantae | Rutaceae | Feronia limonia | Ref. |
Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
Plantae | Rutaceae | Phebalium argenteum | Ref. |
Plantae | Rutaceae | Phebalium clavatum | Ref. |
Plantae | Rutaceae | Ruta chalepensis L. | Ref. |
Plantae | Rutaceae | Ruta graveolens | Ref. |
Plantae | Rutaceae | Zanthoxylum flavum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
- | - | Sarcolobus globosus | Ref. |
|
|
zoom in
Organism | Ficus simplicissima | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Kong, et al., APS, 28, (1993), 432.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
YUAN, et al., Chem Pharm Bull, 50, (2002), 73.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|