Name |
(-)-Jasmonic acid Jasmonic acid trans-Jasmonic acid 3-Oxo-2-(2Z-pentenyl)cyclotentylacetic acid |
Formula |
C12H18O3 |
Mw |
210.12559444 |
CAS RN |
6894-38-8 |
C_ID |
C00000218
,
|
InChIKey |
ZNJFBWYDHIGLCU-AVDNRZGUNA-N |
InChICode |
InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1 |
SMILES |
CC/C=C\C[C@H]1C(=O)CC[C@@H]1CC(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Excavata | Euglenaceae | Euglena gracilis | Ref. |
Fungi | Botryosphaeriaceae | Lasiodiplodia theobromae IFO 31059 | Ref. |
Fungi | Incertae sedis | Botryodiplodia theobromae | Ref. |
Fungi | Nectriaceae | Gibberella fujikuroi | Ref. |
Plantae | Alliaceae | Allium cepa | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Rauvolfia canescens | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Helianthus tuberosus | Ref. |
Plantae | Chlorellaceae | Chlorella sp. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica napus | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Cucurbitaceae | Cucurbita maxima | Ref. |
Plantae | Cucurbitaceae | Cucurbita sp. | Ref. |
Plantae | Equisetaceae | Equisetum arvense | Ref. |
Plantae | Fabaceae | Calliandra haematocephala | Ref. |
Plantae | Fabaceae | Dolichos lablab | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Mimosa pudica | Ref. |
Plantae | Fabaceae | Phaseolus coccineus | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vicia narbonensis | Ref. |
Plantae | Fagaceae | Castanea crenata | Ref. |
Plantae | Fagaceae | Fagus sylvatica | Ref. |
Plantae | Fagaceae | Quercus robur | Ref. |
Plantae | Linaceae | Linum usitatissimum | Ref. |
Plantae | Malvaceae | Malva sylvestris | Ref. |
Plantae | Moraceae | Ficus superba | Ref. |
Plantae | Oleaceae | Jasminum grandiflorum | Ref. |
Plantae | Papaveraceae | Eschscholzia californica | Ref. |
Plantae | Poaceae | Oryza officinalis | Ref. |
Plantae | Poaceae | Secale cereale | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Petunia hybrida | Ref. |
Plantae | Solanaceae | Solanum demissum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum melongena | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Theaceae | Camellia japonica | Ref. |
Plantae | Theaceae | Camellia sasanqua | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Cleyera ochnacea | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
|
|
zoom in
Organism | Jasminum grandiflorum | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Yang, et al., Phytochemistry, 54, (2000), 489 |
---|
|