Name |
Benzoic acid |
Formula |
C7H6O2 |
Mw |
122.03677944 |
CAS RN |
65-85-0 |
C_ID |
C00000207
,
|
InChIKey |
WPYMKLBDIGXBTP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
SMILES |
O=C(O)c1ccccc1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
Animalia | Hominidae | Homo sapiens (Feces) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Fungi | Incertae sedis | Phoma medicaginis | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Uvaria angolensis | Ref. |
Plantae | Annonaceae | Uvaria mocali | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Araceae | Lemna paucicostata | Ref. |
Plantae | Asteraceae | Gynura segetum | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Taraxacum formosanum | Ref. |
Plantae | Begoniaceae | Begonia nantoensis | Ref. |
Plantae | Boraginaceae | Onosma hispida | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Colchicaceae | Burchardia multiflora | Ref. |
Plantae | Convallariaceae | Tupistra chinensis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Brassica oleracea var. gongylodes | Ref. |
Plantae | Cruciferae | Isatis indigotica | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Dennstaedtiaceae | Pteridium aquilinum | Ref. |
Plantae | Fabaceae | Dalbergia cochinchinensis | Ref. |
Plantae | Fabaceae | Dalbergia spruceana | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Senna obtusifolia | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Trifolium incarnatum | Ref. |
Plantae | Flacourtiaceae | Homalium cochinchinensis | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Lauraceae | Persea americana | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
Plantae | Oleaceae | Nyctanthes arbor-tristis Linn. | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Paeoniaceae | Paeonia albiflora | Ref. |
Plantae | Paeoniaceae | Paeonia hybrida | Ref. |
Plantae | Paeoniaceae | Paeonia lactiflora | Ref. |
Plantae | Paeoniaceae | Paeonia peregrina | Ref. |
Plantae | Paeoniaceae | Paeonia suffruticosa | Ref. |
Plantae | Palmae | Daemonorops draco | Ref. |
Plantae | Phytolaccaceae | Petiveria alliacea | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rosaceae | Pygeum africanum | Ref. |
Plantae | Rubiaceae | Coffea arabica | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Turneraceae | Turnera ulmifolia | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
- | - | Bergera koenegii | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Homaliam cochinchinensis | Ref. |
|
|
zoom in
Organism | Abutilon indicum | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|