Name |
Salicylic acid 2-Carboxyphenol Saligel Salonil o-Hydroxybenzoic acid |
Formula |
C7H6O3 |
Mw |
138.03169406 |
CAS RN |
69-72-7 |
C_ID |
C00000206
,
|
InChIKey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
InChICode |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
SMILES |
c1cccc(c1C(=O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
Bacteria | Pseudomonadaceae | Pseudomonas aeruginosa | Ref. |
Plantae | Anacardiaceae | Anacardium occidentale | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Araceae | Sauromatum guttatum | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia scoparia | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Xanthium strumarium | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Colchicaceae | Burchardia multiflora | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis | Ref. |
Plantae | Cruciferae | Isatis indigotica | Ref. |
Plantae | Ericaceae | Gaultheria procumbens | Ref. |
Plantae | Ericaceae | Gaultheria yunnanensis | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
Plantae | Iridaceae | Crocus sativus | Ref. |
Plantae | Juglandaceae | Pterocarya stenoptera | Ref. |
Plantae | Labiatae | Callicarpa integerrima | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Liliaceae | Tulipa gesneriana | Ref. |
Plantae | Malvaceae | Gossypium herbaceum | Ref. |
Plantae | Malvaceae | Malva silvestris | Ref. |
Plantae | Menispermaceae | Menispermum dauricum | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Pinaceae | Abies alba Mill. | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Ranunculaceae | Cimicifuga foetida | Ref. |
Plantae | Rosaceae | Mespilus germanica | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
Plantae | Salicaceae | Populus pseudo-simonii | Ref. |
Plantae | Salicaceae | Populus pseudosimonii | Ref. |
Plantae | Salicaceae | Salix daphnoides | Ref. |
Plantae | Salicaceae | Salix purpurea | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Taxaceae | Taxus baccata | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
- | - | FOOD SAKE | Ref. |
|
|
zoom in
Organism | Moringa peregrine | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|