Name |
Cinnamate trans-Cinnamic acid trans-Cinnamate |
Formula |
C9H8O2 |
Mw |
148.0524295 |
CAS RN |
140-10-3 |
C_ID |
C00000170
,
|
InChIKey |
WBYWAXJHAXSJNI-VOTSOKGWSA-N |
InChICode |
InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
SMILES |
c1ccccc1/C=C/C(=O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Marasmiaceae | Pleurocybella porrigens | Ref. |
Plantae | Acanthaceae | Strobilanthes crispus | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
Plantae | Asteraceae | Helianthus tuberosus | Ref. |
Plantae | Asteraceae | Parthenium argentatum | Ref. |
Plantae | Cistaceae | Cistus ladaniferus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica napus | Ref. |
Plantae | Cruciferae | Brassica oleracea var. gongylodes | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Ephedraceae | Ephedra sinica | Ref. |
Plantae | Erythroxylaceae | Erythroxylum coca | Ref. |
Plantae | Fabaceae | Cassia spectabilis | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Phaseolus aureus | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Globulariaceae | Globularia spp. | Ref. |
Plantae | Hamamelidaceae | Liquidambar orientalis | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Lauraceae | Cinnamomum spp. | Ref. |
Plantae | Liliaceae | Lilium candidum | Ref. |
Plantae | Magnoliaceae | Magnolia denudata | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Poaceae | Gynerium sagittatum | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Scrophulariaceae | Leucophyllum ambiguum | Ref. |
Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
Plantae | Scrophulariaceae | Scrophularia ningpoensis | Ref. |
Plantae | Scrophulariaceae | Scrophularia nodosa | Ref. |
Plantae | Scrophulariaceae | Scrophularia striata | Ref. |
Plantae | Scrophulariaceae | Scrophularia takesimensis | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Vitaceae | Vitis rupestris | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Alpinia spp. | Ref. |
- | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
Organism | Scrophularia striata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|