Name |
Carvacrol |
Formula |
C10H14O |
Mw |
150.10446507 |
CAS RN |
499-75-2 |
C_ID |
C00000156
,
|
InChIKey |
RECUKUPTGUEGMW-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
SMILES |
Cc1ccc(C(C)C)cc1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Cyprinidae | Orthodon hadai | Ref. |
Plantae | -- | Lonicera japonica | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Xylopia sericea | Ref. |
Plantae | Apiaceae | Angelica sinensis | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii | Ref. |
Plantae | Asteraceae | Ageratina jocotepecana | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Baccharis dracunculifolia | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Burseraceae | Canarium album | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Gentianaceae | Gentiana lutea | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Mosla chinensis | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Origanum dubium | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Satureja thymbra | Ref. |
Plantae | Labiatae | Thymus algeriensis | Ref. |
Plantae | Labiatae | Thymus broussonetii | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus caramanicus | Ref. |
Plantae | Labiatae | Thymus daenensis | Ref. |
Plantae | Labiatae | Thymus magnus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus quinquecostatus | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lamiaceae | Coridothymus capitatus | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Ocotea corymbosa | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Piperaceae | Piper betle | Ref. |
Plantae | Ranunculaceae | Nigella sativa L | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Verbenaceae | Lippia chevalieri | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Labiatae | Ref. |
- | - | Origanum | Ref. |
- | - | Thyme | Ref. |
- | - | Trachyspermum roxburghianum | Ref. |
|
|
zoom in
Organism | Thymus daenensis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|