Name |
1,8-Cineol 1,8-Cineole Eucalyptol Cineol Cineole |
Formula |
C10H18O |
Mw |
154.1357652 |
CAS RN |
470-82-6 |
C_ID |
C00000136
,
|
InChIKey |
WEEGYLXZBRQIMU-UHFFFAOYSA-N |
InChICode |
InChI=1S/C10H18O/c1-9(2)8-4-6-10(3,11-9)7-5-8/h8H,4-7H2,1-3H3/t8-,10+ |
SMILES |
C1C[C@H]2CC[C@@]1(OC2(C)C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Ganodermataceae | Ganoderma lucidum | Ref. |
Fungi | Nectriaceae | Fusarium culmorum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Annonaceae | Cananga odorata | Ref. |
Plantae | Annonaceae | Xylopia aethiopica | Ref. |
Plantae | Annonaceae | Xylopia cayennensis | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Apiaceae | Cuminum cyminum L. | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
Plantae | Aristolochiaceae | Asarum heterotropoides var.mandsuricum | Ref. |
Plantae | Aristolochiaceae | Asarum sieboldii | Ref. |
Plantae | Asteraceae | Achillea santolinoids | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
Plantae | Asteraceae | Artemisia anethoides | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia californica | Ref. |
Plantae | Asteraceae | Artemisia cana ssp.viscidula | Ref. |
Plantae | Asteraceae | Artemisia maritima var. stechmannia | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Centaurea orientalis | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chrysanthemum boreale | Ref. |
Plantae | Asteraceae | Conyza newii | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Helichrysum italicum | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Tanacetum vulgare | Ref. |
Plantae | Asteraceae | Tarchonanthus camphoratus | Ref. |
Plantae | Burseraceae | Canarium album | Ref. |
Plantae | Burseraceae | Commiphora mukul | Ref. |
Plantae | Calycanthaceae | Calycanthus floridus | Ref. |
Plantae | Canellaceae | Canella winterana | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica hirta | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Hesperis matronalis | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Euphorbiaceae | Croton lechleri Mull.Arg. | Ref. |
Plantae | Fabaceae | Amorpha fruticosa | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula dentata | Ref. |
Plantae | Labiatae | Lavandula stoechas | Ref. |
Plantae | Labiatae | Mentha arvensis L. | Ref. |
Plantae | Labiatae | Mentha piperita L. | Ref. |
Plantae | Labiatae | Mentha pulegium L. | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia hydrangea | Ref. |
Plantae | Labiatae | Salvia leucophylla | Ref. |
Plantae | Labiatae | Salvia mirzayanii | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia santolinifolia | Ref. |
Plantae | Labiatae | Tetradenia riparia | Ref. |
Plantae | Labiatae | Thymus eriocalyx | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Labiatae | Thymus pubescens | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Thymus X-porlock | Ref. |
Plantae | Labiatae | Vitex trifolia | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
Plantae | Lamiaceae | Coridothymus capitatus | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens | Ref. |
Plantae | Lauraceae | Cinnamomum augustifolium | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum camphorata | Ref. |
Plantae | Lauraceae | Cinnamomum fragrans | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Lindera neesiana | Ref. |
Plantae | Lauraceae | Litsea pungens | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus alba | Ref. |
Plantae | Myrtaceae | Eucalyptus bicostata | Ref. |
Plantae | Myrtaceae | Eucalyptus camaldulensis | Ref. |
Plantae | Myrtaceae | Eucalyptus cinerea | Ref. |
Plantae | Myrtaceae | Eucalyptus cineria | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodara | Ref. |
Plantae | Myrtaceae | Eucalyptus citriodora | Ref. |
Plantae | Myrtaceae | Eucalyptus deglupta | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Eucalyptus grandis | Ref. |
Plantae | Myrtaceae | Eucalyptus leucoxylon | Ref. |
Plantae | Myrtaceae | Eucalyptus macathurii | Ref. |
Plantae | Myrtaceae | Eucalyptus mackliana | Ref. |
Plantae | Myrtaceae | Eucalyptus maideni | Ref. |
Plantae | Myrtaceae | Eucalyptus maidenii | Ref. |
Plantae | Myrtaceae | Eucalyptus microcorys | Ref. |
Plantae | Myrtaceae | Eucalyptus nitens | Ref. |
Plantae | Myrtaceae | Eucalyptus pellita | Ref. |
Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
Plantae | Myrtaceae | Eucalyptus resinifera | Ref. |
Plantae | Myrtaceae | Eucalyptus robusta | Ref. |
Plantae | Myrtaceae | Eucalyptus saligna | Ref. |
Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
Plantae | Myrtaceae | Eucalyptus smithii | Ref. |
Plantae | Myrtaceae | Eucalyptus tereticornis | Ref. |
Plantae | Myrtaceae | Eucalyptus torelliana | Ref. |
Plantae | Myrtaceae | Eucalyptus viminalis | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendron | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Rutaceae | Zanthoxylum bungeanum | Ref. |
Plantae | Rutaceae | Zanthoxylum decaryi | Ref. |
Plantae | Saururaceae | Anemopsis californica | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
Plantae | Turneraceae | Turnera diffusa | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Verbenaceae | Lippia javanica | Ref. |
Plantae | Verbenaceae | Lippia ukambensis | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
Plantae | Zingiberaceae | Alpinia officinarum | Ref. |
Plantae | Zingiberaceae | Alpinia zerumbet | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma kwangsiensis | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
Plantae | Zingiberaceae | Curcuma zedoaria | Ref. |
Plantae | Zingiberaceae | Hedychium coronarium | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Csitus ladaniferus | Ref. |
|
|
zoom in
Organism | Vitex trifolia | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Kim, et al., Planta Med, 69, (2003), 274.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
---|
|