| Name |
Aethiopinone |
| Formula |
C20H24O2 |
| Mw |
296.17763001 |
| CAS RN |
79491-58-0 |
| C_ID |
C00036029
, 
|
| InChIKey |
CAAYVGWMDZSZAD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H24O2/c1-12(2)7-6-8-16-14(5)9-10-15-11-17(13(3)4)19(21)20(22)18(15)16/h9-11,13H,1,6-8H2,2-5H3 |
| SMILES |
C=C(C)CCCc1c(C)ccc2c1C(=O)C(=O)C(C(C)C)=C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia aethiopis | Ref. |
| Plantae | Labiatae | Salvia argentea  | Ref. |
| Plantae | Labiatae | Salvia ceratophylla L. | Ref. |
| Plantae | Labiatae | Salvia eriophora Boiss and Kotschy | Ref. |
| Plantae | Labiatae | Salvia viridis L.  | Ref. |
|
|
zoom in
| Organism | Salvia eriophora Boiss and Kotschy | | Reference | Ulubelen,Phytochem.,64,(2003),395 |
|---|
|