| Name |
(+-)-Mucronulatol 7,3'-Dihydroxy-2',4'-dimethoxyisoflavan Mucronulatol |
| Formula |
C17H18O5 |
| Mw |
302.11542369 |
| CAS RN |
20878-98-2 |
| C_ID |
C00009715
, 
|
| InChIKey |
NUNFZNIXYWTZMW-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H18O5/c1-20-14-6-5-13(17(21-2)16(14)19)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-6,8,11,18-19H,7,9H2,1-2H3/t11-/m0/s1 |
| SMILES |
COc1ccc(C2COc3cc(O)ccc3C2)c(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Astragalus cicer | Ref. |
| Plantae | Fabaceae | Astragalus spp. | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia spp. | Ref. |
| Plantae | Fabaceae | Dalbergia veriabilis | Ref. |
| Plantae | Fabaceae | Machaerium spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sphaerophysa salsula | Ref. |
|
|
zoom in
| Organism | Astragalus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kurosawa,Phytochem.,17,(1978),1389
Kurosawa,Phytochem.,17,(1978),1405 |
|---|
|