| Name |
Alliin |
| Formula |
C6H11NO3S |
| Mw |
177.04596396 |
| CAS RN |
556-27-4 |
| C_ID |
C00001336
, 
|
| InChIKey |
XUHLIQGRKRUKPH-SVRVQNHINA-N |
| InChICode |
InChI=1S/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-,11-/m0/s1 |
| SMILES |
C=CCS(=O)C[C@H](N)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
|
|
zoom in
| Organism | Allium obliquum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|