| Name |
n-Nonadecanoic acid Nonadecanoic acid |
| Formula |
C19H38O2 |
| Mw |
298.28718046 |
| CAS RN |
646-30-0 |
| C_ID |
C00053569
|
| InChIKey |
ISYWECDDZWTKFF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21) |
| SMILES |
CCCCCCCCCCCCCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Strobilanthes crispus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|