| Name |
Isoaloeresin A |
| Formula |
C28H28O11 |
| Mw |
540.16316174 |
| CAS RN |
115940-94-8 |
| C_ID |
C00050858
|
| InChIKey |
QACRJXSXSVUOFZ-IKTLPBAJSA-N |
| InChICode |
InChI=1S/C28H28O11/c1-13-9-18(32)23(26-22(13)19(33)11-17(37-26)10-14(2)30)27-28(25(36)24(35)20(12-29)38-27)39-21(34)8-5-15-3-6-16(31)7-4-15/h3-9,11,20,24-25,27-29,31-32,35-36H,10,12H2,1-2H3/b8-5-/t20-,24-,25+,27+,28-/m1/s1 |
| SMILES |
CC(=O)Cc1cc(=O)c2c(C)cc(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3OC(=O)/C=Cc3ccc(O)cc3)c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
|
|
zoom in
| Organism | Aloe ferox | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|