| Name |
Spinoside A (-)-Spinoside A |
| Formula |
C39H56O12 |
| Mw |
716.37717725 |
| CAS RN |
119626-74-3 |
| C_ID |
C00034277
, 
|
| InChIKey |
UODJOGKPOAZZHT-SUVRKKAKNA-N |
| InChICode |
InChI=1S/C39H56O12/c1-20(40)49-26-19-48-33(30(29(26)44)50-21(2)41)51-25-18-38(9)27-12-11-22-23(17-24(42)32(45)35(22,5)6)36(27,7)15-16-37(38,8)31(25)39(10,47)28(43)13-14-34(3,4)46/h11,13-14,17,23,25-27,29-31,33,42,44,46-47H,12,15-16,18-19H2,1-10H3/b14-13+/t23-,25-,26-,27-,29+,30-,31+,33+,36+,37-,38+,39+/m1/s1 |
| SMILES |
CC(=O)O[C@H]1[C@H](O[C@@H]2C[C@@]3(C)[C@@H]4CC=C5[C@@H](C=C(O)C(=O)C5(C)C)[C@]4(C)CC[C@]3(C)[C@H]2[C@@](C)(O)C(=O)/C=C/C(C)(C)O)OC[C@@H](OC(C)=O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Desfontainiaceae | Desfontainia spinosa | Ref. |
| Plantae | Rutaceae | Euodia meliaefolia  | Ref. |
|
|
zoom in
| Organism | Desfontainia spinosa | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|