| Name |
Fumigaclavine A (8S,9S)-Fumigaclavine A |
| Formula |
C18H22N2O2 |
| Mw |
298.16812796 |
| CAS RN |
6879-59-0 |
| C_ID |
C00011246
, 
|
| InChIKey |
GJSSYQDXZLZOLR-WAFUXUQPNA-N |
| InChICode |
InChI=1S/C18H22N2O2/c1-10-9-20(3)15-7-12-8-19-14-6-4-5-13(16(12)14)17(15)18(10)22-11(2)21/h4-6,8,10,15,17-19H,7,9H2,1-3H3/t10-,15+,17+,18-/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1[C@@H]2c3cccc4[nH]cc(c34)C[C@H]2N(C)C[C@@H]1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Aspergillus tamarii | Ref. |
| Fungi | Trichocomaceae | Neosartorya fumigata | Ref. |
| Fungi | Trichocomaceae | Penicillium commune | Ref. |
| - | - | Aspergullus fumigatus | Ref. |
| - | - | Neosartarya fumigata Af293 | Ref. |
|
|
zoom in
| Organism | Aspergillus fumigatus | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Berde,Handbook of Experimental Pharmacology,Springer-Verlag New York,(1978) |
|---|
|