| Name |
Santal 5,3',4'-Trihydroxy-7-methoxyisoflavone |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
529-60-2 |
| C_ID |
C00009459
, 
|
| InChIKey |
OEYQBKYISMRWQB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-9-5-13(19)15-14(6-9)22-7-10(16(15)20)8-2-3-11(17)12(18)4-8/h2-7,17-19H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)c(-c3ccc(O)c(O)c3)coc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Wyethia helenioides | Ref. |
| Plantae | Asteraceae | Wyethia mollis | Ref. |
| Plantae | Fabaceae | Baphia nitida  | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Pterocarpus osun | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Pterocarpus soyauxii  | Ref. |
|
|
zoom in
| Organism | Wyethia helenioides | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Raudnitz,Ber.Dtsch.Chem.Ges.,68B,(1935),1862
Robertson,J.Chem.Soc.,(1949),1571 |
|---|
|