| Name |
Gallocatechin 3-O-gallate
Gallocatechin gallate |
| Formula |
C22H18O11 |
| Mw |
458.08491142 |
| CAS RN |
5127-64-0 |
| C_ID |
C00008882
, 
|
| InChIKey |
WMBWREPUVVBILR-DBHKEIOZNA-N |
| InChICode |
InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21+/m0/s1 |
| SMILES |
O=C(O[C@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus incanus | Ref. |
| Plantae | Cistaceae | Cistus salviifolius | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron Cunningham's white | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Ericaceae | Rhododendron smirnowii | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Labiatae | Salvia officinalis | Ref. |
| Plantae | Polygonaceae | Polygonum panjutinii | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
| Organism | Cistus incanus |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Varnaite,Chem.Abstr.,99,(1983),35931
Lee,Am.J.Enol.Vitic.,41,(1990),87 |
|---|
|
