| Name |
5',8''-Biluteolin |
| Formula |
C30H18O12 |
| Mw |
570.07982604 |
| CAS RN |
52278-65-6 |
| C_ID |
C00006486
, 
|
| InChIKey |
BRFJUPCQCZSTEU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O12/c31-13-6-17(34)27-20(37)9-24(41-25(27)7-13)12-3-14(29(40)22(39)5-12)26-18(35)8-19(36)28-21(38)10-23(42-30(26)28)11-1-2-15(32)16(33)4-11/h1-10,31-36,39-40H |
| SMILES |
O=c1cc(-c2cc(O)c(O)c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)c(O)c5)oc34)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dicranaceae | Campylopus clavatus | Ref. |
| Plantae | Dicranaceae | Campylopus holomitrium | Ref. |
| Plantae | Dicranaceae | Dicranoloma robustum | Ref. |
| Plantae | Dicranaceae | Dicranum scoparium | Ref. |
| Plantae | Hylocomiaceae | Rhytidiadelphus squarrosus | Ref. |
| Plantae | Leucodontaceae + | Antitrichia curtipendula | Ref. |
| Plantae | Plantaginaceae | Bartramia pomiformis | Ref. |
| Plantae | Plantaginaceae | Bartramia stricta | Ref. |
| - | - | Racomitrium lanuginosum | Ref. |
|
|
zoom in
| Organism | Campylopus clavatus |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Lindberg,Chem.Scrip.,5,(1974),140 |
|---|
|
