| Name |
Myricetin 7,3',4'-trimethyl ether |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
27265-95-8 |
| C_ID |
C00004773
, 
|
| InChIKey |
BHTRHOOJYLEZRA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-9-6-10(19)14-12(7-9)26-17(16(22)15(14)21)8-4-11(20)18(25-3)13(5-8)24-2/h4-7,19-20,22H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3cc(O)c(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus monspeliensis | Ref. |
| Plantae | Cistaceae | Cistus symphytifolius | Ref. |
| Plantae | Crassulaceae | Aeonium sedifolium | Ref. |
| Plantae | Geraniaceae | Geranium spp. | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
|
|
zoom in
| Organism | Cistus monspeliensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wollenweber,Tetrahedron Lett.,(1970),1601 |
|---|
|