| Name |
Myricetin 3,7,3'-trimethyl ether 3,7,3'-Trimethoxy-5,4',5'-trihydroxyflavone 2-(3,4-Dihydroxy-5-methoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
94390-21-3 |
| C_ID |
C00004770
, 
|
| InChIKey |
LVDBEFRVSYPLRQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-9-6-10(19)14-12(7-9)26-17(18(25-3)16(14)22)8-4-11(20)15(21)13(5-8)24-2/h4-7,19-21H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3cc(O)c(O)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Cistaceae | Cistus monspeliensis | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Solanaceae | Iochroma warscewiczii | Ref. |
| Plantae | Solanaceae | Solanum pubescens | Ref. |
|
|
zoom in
| Organism | Cistus albanicus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kurmari,Phytochem.,23,(1984),2701 |
|---|
|