| Name |
Sarothrin |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
57393-71-2 |
| C_ID |
C00004668
, 
|
| InChIKey |
KHZSFBNUQVEEQR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-16-11(20)10-12(21)17(24-2)14(8-4-6-9(19)7-5-8)26-15(10)18(25-3)13(16)22/h4-7,19-20,22H,1-3H3 |
| SMILES |
COc1c(O)c(OC)c2oc(-c3ccc(O)cc3)c(OC)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia grayi | Ref. |
| Plantae | Asteraceae | Baccharis sarothroides | Ref. |
| Plantae | Asteraceae | Encelia densifolia | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
|
|
zoom in
| Organism | Ambrosia grayi |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Roitman,Phytochem.,24,(1985),835 |
|---|
|
