| Name |
Azaleatin |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
529-51-1 |
| C_ID |
C00004633
, 
|
| InChIKey |
RJBAXROZAXAEEM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-11-5-8(17)6-12-13(11)14(20)15(21)16(23-12)7-2-3-9(18)10(19)4-7/h2-6,17-19,21H,1H3 |
| SMILES |
COc1cc(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Cunoniaceae | Eucryphia glutinosa | Ref. |
| Plantae | Dilleniaceae | Tetracera spp. | Ref. |
| Plantae | Ericaceae | Cassiope spp. | Ref. |
| Plantae | Ericaceae | Kalmiopsis leachiana | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Parkia biglobosa  | Ref. |
| Plantae | Fabaceae | Senna lindheimeriana | Ref. |
| Plantae | Fabaceae | Tephrosia watsoniana | Ref. |
| Plantae | Juglandaceae | Carya pecan | Ref. |
| Plantae | Lauraceae | Beilschmiedia miersii | Ref. |
| Plantae | Plumbaginaceae | Plumbago spp. | Ref. |
|
|
zoom in
| Organism | Carthamus tinctorius | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|