| Name |
Gardenin A 5-Hydroxy-3',4',5',6,7,8-hexamethoxyflavone 5-Hydroxy-6,7,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C21H22O9 |
| Mw |
418.1263823 |
| CAS RN |
21187-73-5 |
| C_ID |
C00003976
, 
|
| InChIKey |
MQBFFYQCZCKSBX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O9/c1-24-13-7-10(8-14(25-2)17(13)26-3)12-9-11(22)15-16(23)19(27-4)21(29-6)20(28-5)18(15)30-12/h7-9,23H,1-6H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Gardenia gummifera  | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Tamaricaceae | Tamarix dioica  | Ref. |
|
|
zoom in
| Organism | Gardenia gummifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids,(1967),222,Academic Press
Chhabra,Phytochem.,16,(1976),399 |
|---|
|